| Name |
Cyanidin 3-sophoroside-5-glucoside Cyanidin 3-O-sophoroside-5-O-glucoside |
| Formula |
C33H41O21 |
| Mw |
773.21403338 |
| CAS RN |
47888-56-2 |
| C_ID |
C00006674
, 
|
| InChIKey |
LOXRHOFBKUTJEZ-XPIYMGPJNA-O |
| InChICode |
InChI=1S/C33H40O21/c34-7-18-21(40)24(43)27(46)31(51-18)49-16-5-11(37)4-15-12(16)6-17(29(48-15)10-1-2-13(38)14(39)3-10)50-33-30(26(45)23(42)20(9-36)53-33)54-32-28(47)25(44)22(41)19(8-35)52-32/h1-6,18-28,30-36,40-47H,7-9H2,(H2-,37,38,39)/p+1/t18-,19-,20-,21-,22-,23-,24+,25+,26+,27-,28-,30-,31-,32+,33-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Colchicaceae | Colchicum autumnale  | Ref. |
| Plantae | Convolvulaceae | Ipomoea batatas  | Ref. |
| Plantae | Convolvulaceae | Ipomoea purpurea  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
|
|
zoom in
| Organism | Brassica oleracea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85
Hrazdina,Phytochem.,16,(1977),297 |
|---|
|