| Name |
Cyanidin 3-xyloside |
| Formula |
C20H19O10 |
| Mw |
419.09782183 |
| CAS RN |
29761-24-8 |
| C_ID |
C00006651
, 
|
| InChIKey |
KUCVMQMKRICXJC-WAOLSSODNA-O |
| InChICode |
InChI=1S/C20H18O10/c21-9-4-12(23)10-6-16(30-20-18(27)17(26)14(25)7-28-20)19(29-15(10)5-9)8-1-2-11(22)13(24)3-8/h1-6,14,17-18,20,25-27H,7H2,(H3-,21,22,23,24)/p+1/t14-,17+,18+,20+/m0/s1 |
| SMILES |
Oc1cc(O)c2cc(O[C@@H]3OC[C@@H](O)C(O)C3O)c(-c3ccc(O)c(O)c3)[o+]c2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Ericaceae | Epacris impressa | Ref. |
| Plantae | Rosaceae | Aronia melanocarpa  | Ref. |
| Plantae | Rosaceae | Malus pumila  | Ref. |
| Plantae | Rosaceae | Malus sylvestris  | Ref. |
| Plantae | Saxifragaceae | Saxifraga aizoon | Ref. |
| Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
|
|
zoom in
| Organism | Malus pumila | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Timberlake,J.Sci.Food Agric,22,(1971),509
Oszmianski,J.Food Sci.,53,(1988),1241 |
|---|
|