| Name |
Pelargonidin 3-sophoroside-7-glucoside |
| Formula |
C33H41O20 |
| Mw |
757.21911875 |
| CAS RN |
86279-08-5 |
| C_ID |
C00006649
, 
|
| InChIKey |
BJOPHLFZGFZTLP-XPIYMGPJNA-O |
| InChICode |
InChI=1S/C33H40O20/c34-8-18-21(39)24(42)27(45)31(50-18)47-13-5-15(38)14-7-17(29(48-16(14)6-13)11-1-3-12(37)4-2-11)49-33-30(26(44)23(41)20(10-36)52-33)53-32-28(46)25(43)22(40)19(9-35)51-32/h1-7,18-28,30-36,39-46H,8-10H2,(H-,37,38)/p+1/t18-,19-,20-,21-,22-,23-,24+,25+,26+,27-,28-,30-,31-,32+,33-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3[o+]c2-c2ccc(O)cc2)C(O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Iridaceae | Watsonia meriana | Ref. |
| Plantae | Iridaceae | Watsonia rosea | Ref. |
| Plantae | Iridaceae | Watsonia tabularis  | Ref. |
| Plantae | Papaveraceae | Papaver argemone | Ref. |
| Plantae | Papaveraceae | Papaver nudicaule | Ref. |
| Plantae | Papaveraceae | Papaver orientale  | Ref. |
|
|
zoom in
| Organism | Papaver argemone | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85 |
|---|
|