| Name |
Pelargonidin 3-sambubioside |
| Formula |
C26H29O14 |
| Mw |
565.15573064 |
| CAS RN |
|
| C_ID |
C00006635
, 
|
| InChIKey |
NKUOSFBSKVBOJC-FGQOMUFQNA-O |
| InChICode |
InChI=1S/C26H28O14/c27-8-18-20(33)21(34)24(40-25-22(35)19(32)15(31)9-36-25)26(39-18)38-17-7-13-14(30)5-12(29)6-16(13)37-23(17)10-1-3-11(28)4-2-10/h1-7,15,18-22,24-27,31-35H,8-9H2,(H2-,28,29,30)/p+1/t15-,18-,19-,20+,21+,22-,24+,25-,26+/m0/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)cc2)C(O[C@@H]2OC[C@@H](O)C(O)[C@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aquifoliaceae | Ilex aquifolium  | Ref. |
| Plantae | Aucubaceae | Aucuba japonica | Ref. |
| Plantae | Begoniaceae | Begonia sp.  | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus longicalyx | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus obconica | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus tricolor | Ref. |
| Plantae | Gesneriaceae | Streptocarpus spp. | Ref. |
|
|
zoom in
| Organism | Lathyrus odoratus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85
Ishikura,Bot.Mag.Tokyo,92,(1979),157 |
|---|
|