| Name |
Ochnaflavone |
| Formula |
C30H18O10 |
| Mw |
538.0899968 |
| CAS RN |
50276-96-5 |
| C_ID |
C00006542
, 
|
| InChIKey |
NNPGECDACGBKDH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O10/c31-16-8-20(34)29-22(36)12-24(39-27(29)10-16)14-1-4-18(5-2-14)38-26-7-15(3-6-19(26)33)25-13-23(37)30-21(35)9-17(32)11-28(30)40-25/h1-13,31-35H |
| SMILES |
O=c1cc(-c2ccc(Oc3cc(-c4cc(=O)c5c(O)cc(O)cc5o4)ccc3O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Ochnaceae | Ochna beddomei  | Ref. |
| Plantae | Ochnaceae | Ochna obtusata | Ref. |
| Plantae | Ochnaceae | Ochna pumila | Ref. |
| Plantae | Ochnaceae | Ochna squarrosa | Ref. |
|
|
zoom in
| Organism | Ochna pumila | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Okigawa,Tetrahedron Lett.,(1973),2003
Okigawa,J.Chem.Soc.Perkin Trans.I,(1976),580 |
|---|
|