| Name |
Amentoflavone 7,4',7'',4'''-tetramethyl ether |
| Formula |
C34H26O10 |
| Mw |
594.15259705 |
| CAS RN |
3778-25-4,22783-08-0 |
| C_ID |
C00006501
, 
|
| InChIKey |
VXQYICLHHMETFH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C34H26O10/c1-39-19-8-5-17(6-9-19)27-15-24(37)33-25(38)16-29(42-4)31(34(33)44-27)21-11-18(7-10-26(21)41-3)28-14-23(36)32-22(35)12-20(40-2)13-30(32)43-28/h5-16,35,38H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(OC)c(-c4cc(-c5cc(=O)c6c(O)cc(OC)cc6o5)ccc4OC)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria columnaris | Ref. |
| Plantae | Araucariaceae | Araucaria excelsa | Ref. |
| Plantae | Boweniaceae | Bowenia spp. | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus olivieri | Ref. |
| Plantae | Podocarpaceae | Dacrydium cupressinum  | Ref. |
| Plantae | Podocarpaceae | Lagarostrobos spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus latifolius  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
| Plantae | Zamiaceae | Encephalartos spp. | Ref. |
| Plantae | Zamiaceae | Lepidozamia spp. | Ref. |
| Plantae | Zamiaceae | Zamia angustifolia  | Ref. |
|
|
zoom in
| Organism | Cephalotaxus koreana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|