| Name |
Vitexin 7-O-glucoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
35109-95-6 |
| C_ID |
C00006215
, 
|
| InChIKey |
HHRPSKAYQPDDGQ-VOGSGYLSNA-N |
| InChICode |
InChI=1S/C27H30O15/c28-7-15-19(33)21(35)23(37)26(40-15)18-14(41-27-24(38)22(36)20(34)16(8-29)42-27)6-12(32)17-11(31)5-13(39-25(17)18)9-1-3-10(30)4-2-9/h1-6,15-16,19-24,26-30,32-38H,7-8H2/t15-,16+,19-,20-,21+,22+,23-,24+,26+,27-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea fragrantissima  | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Molluginaceae | Mollugo oppositifolia | Ref. |
| Plantae | Orchidaceae | Cymbidium spp. | Ref. |
|
|
zoom in
| Organism | Cymbidium spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Adamska,Planta Med.,20,(1971),224 |
|---|
|