| Name |
8-C-beta-D-Glucopyranosyldiosmetin 8-beta-D-Glucopyranosyl-5,7,3'-trihydroxy-4'-methoxyflavone 8-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
15822-81-8 |
| C_ID |
C00006121
, 
|
| InChIKey |
NSUGQZFWSLTJRI-PLAKOYNZNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-31-13-3-2-8(4-9(13)24)14-6-12(27)16-10(25)5-11(26)17(21(16)32-14)22-20(30)19(29)18(28)15(7-23)33-22/h2-6,15,18-20,22-26,28-30H,7H2,1H3/t15-,18-,19+,20-,22+/m1/s1 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c([C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lupinus spp. | Ref. |
| Plantae | Passifloraceae | Passiflora coactilis | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
|
|
zoom in
| Organism | Citrus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Gentili,J.Org.Chem.,33,(1968),1571 |
|---|
|