| Name |
Genistein 8-C-glucoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
66026-80-0 |
| C_ID |
C00006118
, 
|
| InChIKey |
HIWJJOYYZFELEZ-KPSHTOCQNA-N |
| InChICode |
InChI=1S/C21H20O10/c22-6-13-17(27)18(28)19(29)21(31-13)15-12(25)5-11(24)14-16(26)10(7-30-20(14)15)8-1-3-9(23)4-2-8/h1-5,7,13,17-19,21-25,27-29H,6H2/t13-,17+,18-,19+,21-/m0/s1 |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia nitidula  | Ref. |
| Plantae | Fabaceae | Dalbergia sissoo  | Ref. |
| Plantae | Fabaceae | Genista ephedroides | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Spartidium saharae | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
|
|
zoom in
| Organism | Lupinus luteus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Kinjo,Chem.Pharm.Bull.,35,(1987),4846,van Heerden,J.Chem.Soc.Perkin Trans.,1,(1980),2463 |
|---|
|