| Name |
6-C-Glucopyranosylkaempferol 6-beta-D-Glucopyranosyl-3,5,7,4'-tetrahydroxyflavone 6-beta-D-Glucopyranosyl-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
28225-10-7 |
| C_ID |
C00006090
, 
|
| InChIKey |
SUZADCRUSDZVCH-PFKHRPHUNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-6-11-14(25)17(28)19(30)21(32-11)12-9(24)5-10-13(15(12)26)16(27)18(29)20(31-10)7-1-3-8(23)4-2-7/h1-5,11,14,17,19,21-26,28-30H,6H2/t11-,14-,17+,19-,21+/m1/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cyclopia intermedia  | Ref. |
| Plantae | Ulmaceae | Zelkova carpinifolia | Ref. |
| Plantae | Ulmaceae | Zelkova serrata | Ref. |
| Plantae | Ulmaceae | Zelkova shneideriana | Ref. |
|
|
zoom in
| Organism | Zelkova shneideriana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Hayashi,Mokuzai Gakkaishi,33,(1987),511
Hayashi,Chem.Abstr.,108,(1988),52754 |
|---|
|