| Name |
Quercetin 3-(2''-galloylglucoside) Quercetin-3-O-(2''-O-galloyl)-beta-D-glucopyranoside |
| Formula |
C28H24O16 |
| Mw |
616.10643472 |
| CAS RN |
69624-79-9 |
| C_ID |
C00005957
, 
|
| InChIKey |
PXGWEUQZDRUMRE-ZKJKSYOBNA-N |
| InChICode |
InChI=1S/C28H24O16/c29-8-18-21(37)23(39)26(43-27(40)10-4-15(34)20(36)16(35)5-10)28(42-18)44-25-22(38)19-14(33)6-11(30)7-17(19)41-24(25)9-1-2-12(31)13(32)3-9/h1-7,18,21,23,26,28-37,39H,8H2/t18-,21-,23+,26-,28+/m1/s1 |
| SMILES |
O=C(O[C@@H]1C(O)[C@H](O)C(CO)O[C@H]1Oc1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c2c1=O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia maculata  | Ref. |
| Plantae | Polygonaceae | Polygonum nodosum | Ref. |
| Plantae | Polygonaceae | Polygonum salicifolium  | Ref. |
|
|
zoom in
| Organism | Polygonum salicifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|