| Name |
Laricitrin 3,7,5'-triglucoside |
| Formula |
C34H42O23 |
| Mw |
818.21168765 |
| CAS RN |
89345-42-6 |
| C_ID |
C00005768
, 
|
| InChIKey |
POYUZVAGWZVXKD-DGHPCACSNA-N |
| InChICode |
InChI=1S/C34H42O23/c1-50-13-2-9(3-14(19(13)39)53-33-28(48)25(45)21(41)16(7-36)55-33)30-31(57-34-29(49)26(46)22(42)17(8-37)56-34)23(43)18-11(38)4-10(5-12(18)52-30)51-32-27(47)24(44)20(40)15(6-35)54-32/h2-5,15-17,20-22,24-29,32-42,44-49H,6-8H2,1H3/t15-,16+,17+,20+,21+,22+,24-,25-,26+,27-,28+,29-,32+,33+,34-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O[C@@H]4O[C@@H](CO)[C@@H](O)C(O)C4O)cc(O)c3c(=O)c2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)cc(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Medicago arborea | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
|
|
zoom in
| Organism | Medicago truncatula | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|