| Name |
Corniculatusin 3-galactoside |
| Formula |
C22H22O13 |
| Mw |
494.10604079 |
| CAS RN |
27560-04-9 |
| C_ID |
C00005704
, 
|
| InChIKey |
HBKIRGQPEXVXGB-JFMIESSJNA-N |
| InChICode |
InChI=1S/C22H22O13/c1-32-19-11(27)5-10(26)13-15(29)21(35-22-17(31)16(30)14(28)12(6-23)33-22)18(34-20(13)19)7-2-3-8(24)9(25)4-7/h2-5,12,14,16-17,22-28,30-31H,6H2,1H3/t12-,14+,16-,17-,22+/m1/s1 |
| SMILES |
COc1c(O)cc(O)c2c(=O)c(O[C@@H]3O[C@H](CO)[C@H](O)C(O)C3O)c(-c3ccc(O)c(O)c3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Geraea canescens | Ref. |
| Plantae | Ericaceae | Erica cinerea | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Rosaceae | Dryas octopetala  | Ref. |
|
|
zoom in
| Organism | Dryas octopetala | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nielsen,Tetrahedryon Lett.,(1970),803
Harborne,Phytochem.,17,(1978),589 |
|---|
|