| Name |
Patuletin 3-O-rutinoside
Patuletin-3-rutinoside |
| Formula |
C28H32O17 |
| Mw |
640.1639496 |
| CAS RN |
19833-26-2 |
| C_ID |
C00005647
, 
|
| InChIKey |
MLOJYABWNDVJMG-LHZANBRKNA-N |
| InChICode |
InChI=1S/C28H32O17/c1-8-16(32)20(36)22(38)27(42-8)41-7-14-17(33)21(37)23(39)28(44-14)45-26-19(35)15-13(6-12(31)25(40-2)18(15)34)43-24(26)9-3-4-10(29)11(30)5-9/h3-6,8,14,16-17,20-23,27-34,36-39H,7H2,1-2H3/t8-,14-,16+,17+,20+,21-,22-,23-,27-,28+/m1/s1 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O[C@@H]3OC(CO[C@@H]4OC(C)[C@H](O)[C@H](O)C4O)[C@@H](O)C(O)C3O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia dracunculus  | Ref. |
| Plantae | Asteraceae | Artemisia herba-alba | Ref. |
| Plantae | Asteraceae | Artemisia monosperma | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Plummera ambigens | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus hilairei | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus polyanthus | Ref. |
|
|
zoom in
| Organism | Hymenoxys scaposa |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Thomas,Phytochem.,7,(1968),787
Wagner,Phytochem.,11,(1972),2633 |
|---|
|
