| Name |
Quercetagetin 7-glucoside |
| Formula |
C21H20O13 |
| Mw |
480.09039073 |
| CAS RN |
548-75-4 |
| C_ID |
C00005633
, 
|
| InChIKey |
IDTDRZPBDLMCLB-BNLZDKBQNA-N |
| InChICode |
InChI=1S/C21H20O13/c22-5-11-14(26)17(29)19(31)21(34-11)33-10-4-9-12(15(27)13(10)25)16(28)18(30)20(32-9)6-1-2-7(23)8(24)3-6/h1-4,11,14,17,19,21-27,29-31H,5H2/t11-,14-,17+,19-,21-/m1/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysactinia mexicana | Ref. |
| Plantae | Asteraceae | Chrysanthemum spp. | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Coreopsis spp. | Ref. |
| Plantae | Asteraceae | Desmanthodium perfoliatum | Ref. |
| Plantae | Asteraceae | Glossopappus macrotus | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Lepidophorum repandum | Ref. |
| Plantae | Asteraceae | Leucanthemopsis flaveola | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Tagetes erecta  | Ref. |
| Plantae | Asteraceae | Tetragonotheca texana | Ref. |
| - | - | Nerolaena spp. | Ref. |
|
|
zoom in
| Organism | Coreopsis spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Rao,Proc.Indian Acad.Sci.Sect.A.,14,(1941),289
Harborne,Biochem.Syst.Ecol.,4,(1976),1 |
|---|
|