| Name |
Isorhamnetin 7-rhamnoside |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
17331-72-5 |
| C_ID |
C00005531
, 
|
| InChIKey |
XLQFMBLUUSGXQY-IUHLULJRNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-8-16(25)18(27)20(29)22(31-8)32-10-6-12(24)15-14(7-10)33-21(19(28)17(15)26)9-3-4-11(23)13(5-9)30-2/h3-8,16,18,20,22-25,27-29H,1-2H3/t8-,16-,18-,20+,22-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O[C@@H]4OC(C)[C@H](O)[C@H](O)C4O)cc(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum caucasicum | Ref. |
| Plantae | Cruciferae | Raphanus raphanistrum  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Fabaceae | Astragalus centralpinus | Ref. |
|
|
zoom in
| Organism | Astragalus centralpinus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Krzeminski,Herba Pol.,23,(1977),291
Zaitsev,Khim.Prir.Soedin.,(1983),527 |
|---|
|