| Name |
Quercetin 3-gentiobioside-7-glucoside |
| Formula |
C33H40O22 |
| Mw |
788.20112297 |
| CAS RN |
84534-23-6 |
| C_ID |
C00005467
, 
|
| InChIKey |
YPWUHQOSVLBEID-BZZUQPSMNA-N |
| InChICode |
InChI=1S/C33H40O22/c34-6-15-19(39)23(43)26(46)31(52-15)49-8-17-21(41)25(45)28(48)33(54-17)55-30-22(42)18-13(38)4-10(50-32-27(47)24(44)20(40)16(7-35)53-32)5-14(18)51-29(30)9-1-2-11(36)12(37)3-9/h1-5,15-17,19-21,23-28,31-41,43-48H,6-8H2/t15-,16+,17-,19-,20-,21-,23+,24+,25-,26-,27+,28-,31-,32-,33+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zygophyllaceae | Fagonia glutinosa | Ref. |
| Plantae | Zygophyllaceae | Fagonia microphylla | Ref. |
| Plantae | Zygophyllaceae | Tribulus longipetalus | Ref. |
| Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Tribulus pentandrus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Saleh,Biochem. Syst. Ecol.,5,(1977),121
Al-Waked,Biochem. Syst. Ecol.,20,(1992),259 |
|---|
|