| Name |
Kaempferide 3-O-beta-D-glucopyranoside Kaempferide 3-glucoside |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
70324-47-9 |
| C_ID |
C00005287
, 
|
| InChIKey |
MQVRGDZCYDEQML-BMMDRJOYNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-30-11-4-2-9(3-5-11)20-21(17(27)15-12(25)6-10(24)7-13(15)31-20)33-22-19(29)18(28)16(26)14(8-23)32-22/h2-7,14,16,18-19,22-26,28-29H,8H2,1H3/t14-,16-,18+,19-,22+/m1/s1 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Costaceae | Costus spicatus  | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Labiatae | Phlomis spectabilis | Ref. |
| Plantae | Solanaceae | Solanum laciniatum  | Ref. |
|
|
zoom in
| Organism | Phlomis spectabilis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Tiwari,Planta Med.,35,(1979),188
Kumar,Phytochem.,24,(1985),1124 |
|---|
|