| Name |
Panasenoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
31512-06-8 |
| C_ID |
C00005157
, 
|
| InChIKey |
LKZDFKLGDGSGEO-NIYHURHTNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(33)20(36)22(38)26(40-14)43-25-21(37)18(34)15(8-29)41-27(25)42-24-19(35)16-12(32)5-11(31)6-13(16)39-23(24)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-22,25-34,36-38H,7-8H2/t14-,15-,17-,18+,20+,21+,22-,25-,26+,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@H](O)C(O)C2O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Sambucus sieboldiana  | Ref. |
| Plantae | Apocynaceae | Thevetia neriifolia | Ref. |
| Plantae | Apocynaceae | Thevetia peruviana  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Fabaceae | Anthyllis sericea | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Hypericaceae | Hypericum spp. | Ref. |
| Plantae | Liliaceae | Lilium candidum  | Ref. |
| Plantae | Rubiaceae | Oldenlandia diffusa  | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
|
|
zoom in
| Organism | Panax ginseng | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Calie,Biochem.Syst.Ecol.,11,(1983),107
Nagy,Naturforsch.,39,(1984),1813 |
|---|
|