| Name |
Kaempferol 3,7-di-O-sulfate |
| Formula |
C15H10O12S2 |
| Mw |
445.96136725 |
| CAS RN |
64291-85-6 |
| C_ID |
C00004947
, 
|
| InChIKey |
CBWPMMFEOJLIPC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O12S2/c16-8-3-1-7(2-4-8)14-15(27-29(22,23)24)13(18)12-10(17)5-9(6-11(12)25-14)26-28(19,20)21/h1-6,16-17H,(H,19,20,21)(H,22,23,24) |
| SMILES |
O=c1c(OS(=O)(=O)O)c(-c2ccc(O)cc2)oc2cc(OS(=O)(=O)O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Pluchea dioscorides  | Ref. |
| Plantae | Dilleniaceae | Dillenia bracteata | Ref. |
| Plantae | Dilleniaceae | Schumacheria castaneifolia | Ref. |
| Plantae | Tamaricaceae | Reaumuria mucronata | Ref. |
|
|
zoom in
| Organism | Reaumuria mucronata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Nawwar,Phytochem.,16,(1977),1319 |
|---|
|