| Name |
Digicitrin |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
5065-10-1 |
| C_ID |
C00004867
, 
|
| InChIKey |
GIEYELPGDHOPHM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O10/c1-25-11-8-9(7-10(22)16(11)26-2)15-18(27-3)13(23)12-14(24)19(28-4)21(30-6)20(29-5)17(12)31-15/h7-8,22,24H,1-6H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(OC)c(OC)c(O)c3c(=O)c2OC)cc(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Plantaginaceae | Digitalis purpurea  | Ref. |
| Plantae | Polygonaceae | Polygonum orientale  | Ref. |
| Plantae | Rutaceae | Zieridium pseudobtusifolium | Ref. |
|
|
zoom in
| Organism | Polygonum orientale | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Meier,Helv.Chim.Acta,45,(1962),232 |
|---|
|