| Name |
Limocitrin |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
489-33-8 |
| C_ID |
C00004731
, 
|
| InChIKey |
IBXCKSUZOFKGSB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-11-5-7(3-4-8(11)18)15-14(22)13(21)12-9(19)6-10(20)16(24-2)17(12)25-15/h3-6,18-20,22H,1-2H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Erica cinerea | Ref. |
| Plantae | Fabaceae | Coronilla valentina | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Rosaceae | Dryas octopetala  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
|
|
zoom in
| Organism | Dryas octopetala | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Horowitz,J.Org.Chem.,26,(1961),2899 |
|---|
|