| Name |
Gossypetin 3,7-dimethyl ether 5,8,3',4',-Tetrahydroxy-3,7-dimethoxyflavone 2-(3,4-Dihydroxyphenyl)-5,8-dihydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
57765-84-1 |
| C_ID |
C00004726
, 
|
| InChIKey |
GZLICDZZLZMPPI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-11-6-10(20)12-14(22)17(24-2)15(25-16(12)13(11)21)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)c(O)c3)oc2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Geraea canescens | Ref. |
| Plantae | Polygonaceae | Chorizanthe diffusa | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Larrea tridentata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Sakakibara,Phytochem.,14,(1975),849 |
|---|
|