| Name |
Gossypetin |
| Formula |
C15H10O8 |
| Mw |
318.0375673 |
| CAS RN |
489-35-0 |
| C_ID |
C00004721
, 
|
| InChIKey |
YRRAGUMVDQQZIY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica  | Ref. |
| Plantae | Ericaceae | Erica cinerea | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa L.  | Ref. |
| Plantae | Rubiaceae | Adina cordifolia Roxb.  | Ref. |
|
|
zoom in
| Organism | Gossypium herbaceum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Baker,J.Chem.Soc.,(1929),74 |
|---|
|