| Name |
Bonanzin 5,7-Dihydroxy-3,6,3',4'-tetramethoxyflavone Quercetagetin 3,6,3',4'-tetramethyl ether 2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
35688-42-7 |
| C_ID |
C00004706
, 
|
| InChIKey |
SDTFURCSGWUESP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-11-6-5-9(7-12(11)24-2)17-19(26-4)16(22)14-13(27-17)8-10(20)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Bahia oppositifolia | Ref. |
| Plantae | Asteraceae | Bahia xylopoda | Ref. |
| Plantae | Asteraceae | Brickellia spp. | Ref. |
| Plantae | Asteraceae | Parthenium ligulatum | Ref. |
| Plantae | Asteraceae | Perityle vaseyi | Ref. |
| Plantae | Asteraceae | Stevia cuzcoensis | Ref. |
| Plantae | Asteraceae | Tagetes rupestris | Ref. |
| Plantae | Labiatae | Vitex trifoliata | Ref. |
| Plantae | Plantaginaceae | Limnophila gratissima | Ref. |
|
|
zoom in
| Organism | Brickellia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Herz,Phytochem.,11,(1972),371 |
|---|
|