| Name |
Herbacetin 7,8-dimethyl ether 3,5,4'-Trihydroxy-7,8-dimethoxyflavone 3,5-Dihydroxy-2-(4-hydroxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
71468-52-5 |
| C_ID |
C00004616
, 
|
| InChIKey |
JQUOXVDGPYAXTH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-11-7-10(19)12-13(20)14(21)15(24-17(12)16(11)23-2)8-3-5-9(18)6-4-8/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium gracile | Ref. |
| Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
| Plantae | Asteraceae | Ozothamnus obcordatus | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
|
|
zoom in
| Organism | Cheilanthes argentea | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Torrenegra,Rev.Latinoam.Quim.,15,(1984),129 |
|---|
|