| Name |
3,3',4',7-Tetramethoxyflavone 3,7,3',4'-Tetramethoxyflavone Fisetin tetramethyl ether |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
17093-86-6 |
| C_ID |
C00004584
, 
|
| InChIKey |
NAMFTZBUZYVNST-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-21-12-6-7-13-15(10-12)25-18(19(24-4)17(13)20)11-5-8-14(22-2)16(9-11)23-3/h5-10H,1-4H3 |
| SMILES |
COc1ccc2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Fabaceae | Colophospermum mopane  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Umtiza listerana | Ref. |
|
|
zoom in
| Organism | Umtiza listerana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Mukerjee,Indian J.Chem.,7,(1969),1275 |
|---|
|