| Name |
Geraldol |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
21511-25-1 |
| C_ID |
C00004581
, 
|
| InChIKey |
WRFQRUBJBPLPAM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-13-6-8(2-5-11(13)18)16-15(20)14(19)10-4-3-9(17)7-12(10)22-16/h2-7,17-18,20H,1H3 |
| SMILES |
COc1cc(-c2oc3cc(O)ccc3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Anthyllis vulneraria  | Ref. |
| Plantae | Fabaceae | Lotus corniculatus | Ref. |
| Plantae | Fabaceae | Sophora secundiflora | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa | Ref. |
| - | - | Tetragonolobus siliquosus | Ref. |
|
|
zoom in
| Organism | Trifolium subterraneum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wong,Phytochem.,7,(1968),2123 |
|---|
|
