| Name |
Isognaphaliin 5,8-Dihydroxy-3,7-dimethoxyflavone 5,8-Dihydroxy-3,7-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
33803-31-5 |
| C_ID |
C00004555
, 
|
| InChIKey |
FIERIMLAOJMXIK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-11-8-10(18)12-14(20)17(22-2)15(23-16(12)13(11)19)9-6-4-3-5-7-9/h3-8,18-19H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccccc3)oc2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline flaccida | Ref. |
| Plantae | Asteraceae | Achyrocline satureoides | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus solandri | Ref. |
| Plantae | Pteridaceae | Notholaena candida | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
|
|
zoom in
| Organism | Notholaena candida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wagner,Chem.Ber.,104,(1971),2381 |
|---|
|