| Name |
6-Hydroxyluteolin 7-apioside |
| Formula |
C20H18O11 |
| Mw |
434.08491142 |
| CAS RN |
76318-87-1 |
| C_ID |
C00004385
, 
|
| InChIKey |
QWGPBCPIKAIUCO-ICFUPFJMNA-N |
| InChICode |
InChI=1S/C20H18O11/c21-6-20(28)7-29-19(18(20)27)31-14-5-13-15(17(26)16(14)25)11(24)4-12(30-13)8-1-2-9(22)10(23)3-8/h1-5,18-19,21-23,25-28H,6-7H2/t18-,19-,20-/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OCC(O)(CO)C3O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Lepidagathis cristata | Ref. |
| Plantae | Velloziaceae | Pleurostima caricina | Ref. |
| Plantae | Velloziaceae | Pleurostima purpurea | Ref. |
| Plantae | Verbenaceae | Phyla nodiflora  | Ref. |
|
|
zoom in
| Organism | Phyla nodiflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Williams,Biochem.Syst.Ecol.,19,(1991),483 |
|---|
|