| Name |
Luteolin 5-methyl ether 7-glucoside |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
58115-30-3 |
| C_ID |
C00004332
, 
|
| InChIKey |
FAFFFXZNMUEBBD-OXFOAJKANA-N |
| InChICode |
InChI=1S/C22H22O11/c1-30-15-5-10(31-22-21(29)20(28)19(27)17(8-23)33-22)6-16-18(15)13(26)7-14(32-16)9-2-3-11(24)12(25)4-9/h2-7,17,19-25,27-29H,8H2,1H3/t17-,19+,20-,21+,22+/m0/s1 |
| SMILES |
COc1cc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc2oc(-c3ccc(O)c(O)c3)cc(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Juncaceae | Juncus acutus  | Ref. |
| Plantae | Juncaceae | Juncus effusus  | Ref. |
| Plantae | Juncaceae | Luzula arcuata | Ref. |
| Plantae | Juncaceae | Luzula nutans | Ref. |
| Plantae | Juncaceae | Luzula sylvatica | Ref. |
|
|
zoom in
| Organism | Luzula nutans | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Biochem.Syst.Ecol.,3,(1975),181 |
|---|
|