| Name |
Luteolin 5-O-beta-D-glucopyranoside Luteolin 5-glucoside Luteolin-5-O-beta-D-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
20344-46-1 |
| C_ID |
C00004261
, 
|
| InChIKey |
KBGKQZVCLWKUDQ-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-15-5-9(23)4-14-17(15)12(26)6-13(30-14)8-1-2-10(24)11(25)3-8/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Scorzonera pseudodivaricata | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Fabaceae | Galega officinalis  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum var.angustifolium  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Scrophulariaceae | Verbascum lychnitis | Ref. |
|
|
zoom in
| Organism | Galega officinalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Barger,Biochem.J.,17,(1923),836 |
|---|
|