| Name |
Hispidulin-7-O-beta-D-glucuronide Hispidulin 7-O-beta-glucuronide (-)-Hispidulin 7-O-beta-glucuronide Hispidulin 7-glucuronide |
| Formula |
C22H20O12 |
| Mw |
476.09547611 |
| CAS RN |
31105-76-7 |
| C_ID |
C00004232
, 
|
| InChIKey |
GVEZRDBRYNJUDQ-JNFAVNEGNA-N |
| InChICode |
InChI=1S/C22H20O12/c1-31-19-13(33-22-18(28)16(26)17(27)20(34-22)21(29)30)7-12-14(15(19)25)10(24)6-11(32-12)8-2-4-9(23)5-3-8/h2-7,16-18,20,22-23,25-28H,1H3,(H,29,30)/t16-,17-,18+,20+,22+/m0/s1 |
| SMILES |
COc1c(O[C@@H]2OC(C(=O)O)[C@@H](O)[C@H](O)C2O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Labiatae | Scutellaria creticola | Ref. |
| Plantae | Pedaliaceae | Pedalium murex  | Ref. |
| Plantae | Verbenaceae | Verbena bonariensis  | Ref. |
|
|
zoom in
| Organism | Verbena bonariensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|