| Name |
Scutellarein 7-glucuronide Scutellarin |
| Formula |
C21H18O12 |
| Mw |
462.07982604 |
| CAS RN |
27740-01-8 |
| C_ID |
C00004221
, 
|
| InChIKey |
DJSISFGPUUYILV-GGNWGOABNA-N |
| InChICode |
InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/t16-,17-,18+,19+,21+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](Oc2cc3oc(-c4ccc(O)cc4)cc(=O)c3c(O)c2O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria polyodon | Ref. |
|
|
zoom in
| Organism | Scutellaria polyodon | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Boikova,Khim.Prir.Soedin.,(1969),596 |
|---|
|