| Name |
Plantaginin Scutellarein 7-O-beta-glucopyranoside Scutellarein 7-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
26046-94-6 |
| C_ID |
C00004220
, 
|
| InChIKey |
VUGRLRAUZWGZJP-NFBJXHJONA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-14-17(26)19(28)20(29)21(32-14)31-13-6-12-15(18(27)16(13)25)10(24)5-11(30-12)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
| Plantae | Iridaceae | Crocus chrysanthus | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Lamiaceae | Betonica officinalis  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
|
|
zoom in
| Organism | Crocus sativus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|