| Name |
Cyclomorusin Cyclomulberrochromene 6,11-Dihydroxy-3,3-dimethyl-8-(2-methyl-1-propenyl)-3H,7H,8H-bis[1]benzopyrano[4,3-b:6',5'-e]pyran-7-one |
| Formula |
C25H22O6 |
| Mw |
418.14163844 |
| CAS RN |
62596-34-3 |
| C_ID |
C00004029
, 
|
| InChIKey |
GDQXJMLXEYSICD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H22O6/c1-12(2)9-19-21-22(28)20-16(27)11-18-15(7-8-25(3,4)31-18)23(20)30-24(21)14-6-5-13(26)10-17(14)29-19/h5-11,19,26-27H,1-4H3/t19-/m1/s1 |
| SMILES |
CC(C)=CC1Oc2cc(O)ccc2-c2oc3c4c(cc(O)c3c(=O)c21)OC(C)(C)C=C4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus altilis  | Ref. |
| Plantae | Moraceae | Artocarpus communis  | Ref. |
| Plantae | Moraceae | Artocarpus elasticus  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
|
|
zoom in
| Organism | Morus alba | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Deshpande,Tetrahedron Lett.,(1968),1715
Numura,Chem.Pharm.Bull.,26,(1978),1394 |
|---|
|