| Name |
Lanceolatin A Lanceolatin A(flavonoid) |
| Formula |
C21H20O4 |
| Mw |
336.13615913 |
| CAS RN |
41689-78-5 |
| C_ID |
C00004010
, 
|
| InChIKey |
GWHQUBFEZSVTKH-VAWYXSNFSA-N |
| InChICode |
InChI=1S/C21H20O4/c1-21(2,23)12-11-16-18(24-3)10-9-15-17(22)13-19(25-20(15)16)14-7-5-4-6-8-14/h4-13,23H,1-3H3/b12-11+ |
| SMILES |
COc1ccc2c(=O)cc(-c3ccccc3)oc2c1/C=C/C(C)(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
| Plantae | Fabaceae | Tephrosia apollinea  | Ref. |
| Plantae | Fabaceae | Tephrosia lanceolata | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
|
|
zoom in
| Organism | Tephrosia purpurea | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Ayengar,Indian J.Chem. Sect.B,11,(1973),85
Waterman,Phytochem.,19,(1980),909 |
|---|
|