| Name |
5,6,7,8,3',4',5'-Heptamethoxyflavone |
| Formula |
C22H24O9 |
| Mw |
432.14203237 |
| CAS RN |
6965-36-2 |
| C_ID |
C00003977
, 
|
| InChIKey |
UAELIRBOLQZEAT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H24O9/c1-24-14-8-11(9-15(25-2)17(14)26-3)13-10-12(23)16-18(27-4)20(28-5)22(30-7)21(29-6)19(16)31-13/h8-10H,1-7H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Asteraceae | Ageratum corymbosum | Ref. |
| Plantae | Asteraceae | Ageratum tomentosum | Ref. |
| Plantae | Asteraceae | Conoclinium greggii | Ref. |
| Plantae | Asteraceae | Eupatorium coelestinum | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Ageratum tomentosum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Le-Van,Phytochem.,18,(1979),1859
Vazquez,Phytochem.,27,(1988),3706 |
|---|
|