| Name |
5,7,8,3',4'-Pentahydroxy-6-methoxyflavone |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
90851-12-0 |
| C_ID |
C00003925
, 
|
| InChIKey |
BCQKWILTFJFWRE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-16-12(20)11-9(19)5-10(24-15(11)13(21)14(16)22)6-2-3-7(17)8(18)4-6/h2-5,17-18,20-22H,1H3 |
| SMILES |
COc1c(O)c(O)c2oc(-c3ccc(O)c(O)c3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Hemizonia fasciculata | Ref. |
| Plantae | Asteraceae | Hemizonia increscens villosa | Ref. |
| Plantae | Asteraceae | Hemizonia lobbii | Ref. |
| Plantae | Asteraceae | Hemizonia pentactis | Ref. |
|
|
zoom in
| Organism | Hemizonia pentactis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Proksch,Phytochem.,23,(1984),679 |
|---|
|