| Name |
Pilloin 5,3'-Dihydroxy-7,4'-dimethoxyflavone Luteolin 7,4'-dimethyl ether 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
32174-62-2 |
| C_ID |
C00003868
, 
|
| InChIKey |
UDBHJDTXPDRDNS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-6-12(19)17-13(20)8-15(23-16(17)7-10)9-3-4-14(22-2)11(18)5-9/h3-8,18-19H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia iwayomogi | Ref. |
| Plantae | Asteraceae | Baccharis crispa | Ref. |
| Plantae | Asteraceae | Baccharis trinervis  | Ref. |
| Plantae | Asteraceae | Lychnophora affinis | Ref. |
| Plantae | Asteraceae | Onopordum laconicum | Ref. |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Bignoniaceae | Godmania aesculifolia | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia brevipedicellata | Ref. |
| Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
| Plantae | Labiatae | Lycopus virginicus  | Ref. |
| Plantae | Labiatae | Orthosiphon spicatus | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Piperaceae | Piper auritum  | Ref. |
| Plantae | Plantaginaceae | Antirrhinum braun-blanquetii | Ref. |
| Plantae | Plantaginaceae | Antirrhinum graniticum | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Pteridaceae | Notholaena nivea | Ref. |
| Plantae | Thymelaeaceae | Ovidia pillo-pillo | Ref. |
| Plantae | Winteraceae | Belliolum gracile | Ref. |
| Plantae | Winteraceae | Tasmannia piperita | Ref. |
|
|
zoom in
| Organism | Lychnophora affinis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Nunez-Alarcon,J.Org.Chem.,36,(1971),3829
Williams, Phytochem.,21,(1982),329 |
|---|
|