| Name |
Polypodine B |
| Formula |
C27H44O8 |
| Mw |
496.30361838 |
| CAS RN |
18069-14-2 |
| C_ID |
C00003666
, 
|
| InChIKey |
GMFLGNRCCFYOKL-RTTQFPFINA-N |
| InChICode |
InChI=1S/C27H44O8/c1-22(2,32)9-8-20(30)25(5,33)19-7-11-26(34)16-12-21(31)27(35)14-18(29)17(28)13-24(27,4)15(16)6-10-23(19,26)3/h12,15,17-20,28-30,32-35H,6-11,13-14H2,1-5H3/t15-,17-,18+,19-,20+,23+,24+,25+,26+,27+/m0/s1 |
| SMILES |
CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@]4(O)C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes fauriei | Ref. |
| Plantae | Amaranthaceae | Pfaffia iresinoides  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Caryophyllaceae | Lychnis coronaria  | Ref. |
| Plantae | Caryophyllaceae | Lychnis fulgens | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Axyris amaranthoides | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Labiatae | Ajuga decumbens  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Polypodiaceae | Polypodium vulgare  | Ref. |
| - | - | Ourisia caespitosa | Ref. |
| - | - | Ourisia macrocarpa | Ref. |
| - | - | Ourisia macrophylla | Ref. |
| - | - | Ourisia sessilifolia | Ref. |
|
|
zoom in
| Organism | Lychnis coronaria | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Takasaki, et al., JNP, 62, (1999), 972.
Dai, et al., NPRD, 14, (2002), 9 |
|---|
|