| Name |
Tulipinolide |
| Formula |
C17H22O4 |
| Mw |
290.15180919 |
| CAS RN |
24164-12-3 |
| C_ID |
C00003378
, 
|
| InChIKey |
UPNVKIZABMRHNR-QEAAIBRDNA-N |
| InChICode |
InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h6,9,14-16H,3,5,7-8H2,1-2,4H3/b10-6+,11-9+/t14-,15-,16+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2/C=C(C)CC/C=C(C)C[C@H](OC(C)=O)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia camphorata | Ref. |
| Plantae | Asteraceae | Ambrosia dumosa | Ref. |
| Plantae | Asteraceae | Artemisia mexicana | Ref. |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipfera | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
|
|
zoom in
| Organism | Conocephalum conicum | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998) |
|---|
|