| Name |
Tomentosin
Xanthalongin |
| Formula |
C15H20O3 |
| Mw |
248.1412445 |
| CAS RN |
33649-15-9 |
| C_ID |
C00003376
, 
|
| InChIKey |
AVFIYMSJDDGDBQ-ZQWJIHNYNA-N |
| InChICode |
InChI=1S/C15H20O3/c1-9-8-14-13(11(3)15(17)18-14)7-6-12(9)5-4-10(2)16/h6,9,13-14H,3-5,7-8H2,1-2H3/t9-,13+,14+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2C[C@H](C)C(CCC(C)=O)=CC[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Marsdenia tomentosa Decne. | Ref. |
| Plantae | Asteraceae | Dittrichia graveolens (L.) GREUTER  | Ref. |
| Plantae | Asteraceae | Inula helenium | Ref. |
| Plantae | Asteraceae | Inula japonica | Ref. |
| Plantae | Asteraceae | Parthenium tomentosum | Ref. |
| Plantae | Fagaceae | Castanea mollissima | Ref. |
| Plantae | Myrtaceae | Rhodomyrtus tomentosa | Ref. |
|
|
zoom in
| Organism | Inula japonica |
|---|
| Reference | Liu, et al., NPRD, 10, (1998), 14.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
