| Name |
Warburganal |
| Formula |
C15H22O3 |
| Mw |
250.15689457 |
| CAS RN |
62994-47-2 |
| C_ID |
C00003202
, 
|
| InChIKey |
QGMWDUUHVVLHNP-FJBXCPOZNA-N |
| InChICode |
InChI=1S/C15H22O3/c1-13(2)7-4-8-14(3)12(13)6-5-11(9-16)15(14,18)10-17/h5,9-10,12,18H,4,6-8H2,1-3H3/t12-,14-,15+/m0/s1 |
| SMILES |
CC1(C)CCC[C@@]2(C)[C@H]1CC=C(C=O)[C@]2(O)C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Canellaceae | Warburgia salutaris | Ref. |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
| Plantae | Rubiaceae | Alberta magna | Ref. |
|
|
zoom in
| Organism | Polygonum hydropiper |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
