| Name |
Guaiazulene |
| Formula |
C15H18 |
| Mw |
198.14085057 |
| CAS RN |
489-84-9 |
| C_ID |
C00003138
, 
|
| InChIKey |
FWKQNCXZGNBPFD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H18/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-10H,1-4H3 |
| SMILES |
Cc1ccc(C(C)C)cc2c(C)ccc1-2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
| Plantae | Zygophyllaceae | Guaiacum officinale | Ref. |
| Plantae | Zygophyllaceae | Guaiacum sanctum | Ref. |
|
|
zoom in
| Organism | Thymus broussonetti |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
