| Name |
Isoplumericin |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
31298-76-7 |
| C_ID |
C00003087
, 
|
| InChIKey |
VFXXNAVZODKBIW-JOUKRYDTNA-N |
| InChICode |
InChI=1S/C15H14O6/c1-3-7-11-15(21-13(7)17)5-4-8-9(12(16)18-2)6-19-14(20-11)10(8)15/h3-6,8,10-11,14H,1-2H3/b7-3-/t8-,10+,11-,14-,15+/m0/s1 |
| SMILES |
C/C=C1C(=O)O[C@]23C=C[C@@H]4C(C(=O)OC)=CO[C@H](O[C@@H]12)[C@@H]43 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Plumeria bicolor | Ref. |
| Plantae | Apocynaceae | Plumeria rubra  | Ref. |
| Plantae | Apocynaceae | Plumeria spp. | Ref. |
| - | - | Allemanda cathartica  | Ref. |
|
|
zoom in
| Organism | Allemanda cathartica | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|