| Name |
Mallotusinic acid |
| Formula |
C48H32O32 |
| Mw |
1120.08766893 |
| CAS RN |
66421-47-4 |
| C_ID |
C00002931
, 
|
| InChIKey |
IHHYLDUUGFQCFR-UMFMYUOJNA-N |
| InChICode |
InChI=1S/C48H32O32/c49-15-1-9(2-16(50)27(15)55)41(65)79-46-39-38-36(76-45(69)13-7-22(54)48(72)47(70,71)26(13)25-11(44(68)78-39)4-19(53)30(58)37(25)80-48)21(75-46)8-73-42(66)12-6-20(74-35-14(40(63)64)5-18(52)29(57)34(35)62)31(59)33(61)24(12)23-10(43(67)77-38)3-17(51)28(56)32(23)60/h1-7,21,26,36,38-39,46,49-53,55-62,70-72H,8H2,(H,63,64)/t21-,26+,36-,38+,39-,46+,48+/m1/s1 |
| SMILES |
O=C1O[C@@H]2C3COC(=O)c4cc(Oc5c(C(=O)O)cc(O)c(O)c5O)c(O)c(O)c4-c4c(cc(O)c(O)c4O)C(=O)O[C@@H]2C(OC(=O)c2cc(O)c(O)c4c2[C@@H]2C1=CC(=O)[C@](O)(O4)C2(O)O)[C@H](OC(=O)c1cc(O)c(O)c(O)c1)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Alchornea trewioides  | Ref. |
| Plantae | Euphorbiaceae | Aleurites cordata | Ref. |
| Plantae | Euphorbiaceae | Euphorbia spp. | Ref. |
| Plantae | Euphorbiaceae | Mallotus japonicus  | Ref. |
|
|
zoom in
| Organism | Mallotus japonicus | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter45 |
|---|
|