| Name |
Dihydroresveratrol 3,4',5-Trihydroxybibenzyl |
| Formula |
C14H14O3 |
| Mw |
230.09429431 |
| CAS RN |
58436-28-5 |
| C_ID |
C00002879
, 
|
| InChIKey |
HITJFUSPLYBJPE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H14O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h3-9,15-17H,1-2H2 |
| SMILES |
Oc1ccc(CCc2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea dumetorum  | Ref. |
| Plantae | Moraceae | Morus sp. | Ref. |
| Plantae | Moraceae | Morus spp. | Ref. |
| Plantae | Orchidaceae | Bulbophyllum triste | Ref. |
|
|
zoom in
| Organism | Morus sp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|