| Name |
Phylloquinone trans-Phylloquinone Vitamin K1(20) Vitamin K1 |
| Formula |
C31H46O2 |
| Mw |
450.34978071 |
| CAS RN |
84-80-0 |
| C_ID |
C00002868
, 
|
| InChIKey |
MBWXNTAXLNYFJB-CCNXOCMANA-N |
| InChICode |
InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+/t23-,24-/m1/s1 |
| SMILES |
CC1=C(C/C=C(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=O)c2ccccc2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. italica  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
|
|
zoom in
| Organism | Hippophae rhamnoides | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|