| Name |
Pseudopurpurin |
| Formula |
C15H8O7 |
| Mw |
300.02700261 |
| CAS RN |
476-41-5 |
| C_ID |
C00002856
, 
|
| InChIKey |
OOKBSCGBRWBGFL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O7/c16-10-5-3-1-2-4-6(5)11(17)8-7(10)12(18)9(15(21)22)14(20)13(8)19/h1-4,18-20H,(H,21,22) |
| SMILES |
O=C(O)c1c(O)c(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Asperula spp. | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Relbunium spp. | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia  | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum  | Ref. |
| Plantae | Rubiaceae | Sherardia arvensis | Ref. |
|
|
zoom in
| Organism | Rubia cordifolia | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|